EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O6 |
| Net Charge | 0 |
| Average Mass | 268.265 |
| Monoisotopic Mass | 268.09469 |
| SMILES | Cc1cc(O)cc(O)c1C(=O)OCC(=O)C[C@H](C)O |
| InChI | InChI=1S/C13H16O6/c1-7-3-9(15)5-11(17)12(7)13(18)19-6-10(16)4-8(2)14/h3,5,8,14-15,17H,4,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | XPROBYNUZWGFGY-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (15921417) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globosumone B (CHEBI:68706) has functional parent o-orsellinic acid (CHEBI:32807) |
| globosumone B (CHEBI:68706) has role Chaetomium metabolite (CHEBI:76960) |
| globosumone B (CHEBI:68706) has role antineoplastic agent (CHEBI:35610) |
| globosumone B (CHEBI:68706) has role metabolite (CHEBI:25212) |
| globosumone B (CHEBI:68706) is a benzoate ester (CHEBI:36054) |
| globosumone B (CHEBI:68706) is a resorcinols (CHEBI:33572) |
| IUPAC Names |
|---|
| 2'-oxo-4'S-hydroxypentyl orsellinate |
| (4S)-4-hydroxy-2-oxopentyl 2,4-dihydroxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 9657373 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11045322 | Reaxys |
| Citations |
|---|