EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H38O16 |
| Net Charge | 0 |
| Average Mass | 750.706 |
| Monoisotopic Mass | 750.21599 |
| SMILES | Cc1cc(O)cc(O)c1C(=O)OC(C)Cc1cc(O)cc(O)c1C(=O)OC(C)Cc1cc(O)cc(O)c1C(=O)OC(C)Cc1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C38H38O16/c1-16-5-23(39)12-27(43)31(16)36(49)52-18(3)7-21-10-25(41)14-29(45)33(21)38(51)54-19(4)8-22-11-26(42)15-30(46)34(22)37(50)53-17(2)6-20-9-24(40)13-28(44)32(20)35(47)48/h5,9-15,17-19,39-46H,6-8H2,1-4H3,(H,47,48) |
| InChIKey | HCXQIVLHUHTXGC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fungi | - | PubMed (11217798) | Strain: 17415 |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR191512 (CHEBI:65912) has functional parent o-orsellinic acid (CHEBI:32807) |
| FR191512 (CHEBI:65912) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| FR191512 (CHEBI:65912) has role metabolite (CHEBI:25212) |
| FR191512 (CHEBI:65912) is a benzoate ester (CHEBI:36054) |
| FR191512 (CHEBI:65912) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 2-{2-[(2-{2-[(2-{2-[(2,4-dihydroxy-6-methylbenzoyl)oxy]propyl}-4,6-dihydroxybenzoyl)oxy]propyl}-4,6-dihydroxybenzoyl)oxy]propyl}-4,6-dihydroxybenzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8750768 | Reaxys |
| Citations |
|---|