EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O8 |
| Net Charge | 0 |
| Average Mass | 400.383 |
| Monoisotopic Mass | 400.11582 |
| SMILES | C/C=C/C1=CC2=CC(=O)[C@@](C)(OC(=O)c3c(C)cc(O)cc3O)C(=O)[C@@]2(O)CO1 |
| InChI | InChI=1S/C21H20O8/c1-4-5-14-7-12-8-16(24)20(3,19(26)21(12,27)10-28-14)29-18(25)17-11(2)6-13(22)9-15(17)23/h4-9,22-23,27H,10H2,1-3H3/b5-4+/t20-,21-/m1/s1 |
| InChIKey | MZHBZSGFVGKNQP-QLAYCGNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| purpurquinone C (CHEBI:69471) has functional parent o-orsellinic acid (CHEBI:32807) |
| purpurquinone C (CHEBI:69471) has role Penicillium metabolite (CHEBI:76964) |
| purpurquinone C (CHEBI:69471) is a azaphilone (CHEBI:50941) |
| purpurquinone C (CHEBI:69471) is a benzoate ester (CHEBI:36054) |
| purpurquinone C (CHEBI:69471) is a enone (CHEBI:51689) |
| purpurquinone C (CHEBI:69471) is a isochromenes (CHEBI:38761) |
| purpurquinone C (CHEBI:69471) is a polyketide (CHEBI:26188) |
| purpurquinone C (CHEBI:69471) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (7R,8aS)-8a-hydroxy-7-methyl-6,8-dioxo-3-[(1E)-prop-1-en-1-yl]-6,7,8,8a-tetrahydro-1H-isochromen-7-yl 2,4-dihydroxy-6-methylbenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878451 | Reaxys |
| Citations |
|---|