EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:32398 - D-glyceric acid
| Formula | C3H6O4 |
| Net Charge | 0 |
| Average Mass | 106.077 |
| Monoisotopic Mass | 106.02661 |
| SMILES | O=C(O)[C@H](O)CO |
| InChI | InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-/m1/s1 |
| InChIKey | RBNPOMFGQQGHHO-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glyceric acid (CHEBI:32398) is a glyceric acid (CHEBI:33508) |
| D-glyceric acid (CHEBI:32398) is conjugate acid of D-glycerate (CHEBI:16659) |
| D-glyceric acid (CHEBI:32398) is enantiomer of L-glyceric acid (CHEBI:74324) |
| Incoming Relation(s) |
| P-{α-D-GlcpNAc-(1→3)-[D-GroA-(2→1)]-α-D-GlcpNAc-6-yl}-α-D-GlcpNAc-(1→3)-[P-6-[CH2]5NH2]-α-D-GlcpNAc-(1→2)-D-GroA (CHEBI:134201) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-(α-D-glucopyranosyl)-D-glyceric acid (CHEBI:62509) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-(α-D-glucopyranosyl)-3-O-phospho-D-glyceric acid (CHEBI:62601) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-[6-O-octanoyl-α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid (CHEBI:137553) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid (CHEBI:137558) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-[α-D-mannopyranosyl-(1→2)-α-D-glucopyranosyl]-3-O-phospho-D-glyceric acid (CHEBI:62603) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-phospho-D-glyceric acid (CHEBI:17835) has functional parent D-glyceric acid (CHEBI:32398) |
| 2,3-bisphospho-D-glyceric acid (CHEBI:17720) has functional parent D-glyceric acid (CHEBI:32398) |
| 3-phospho-D-glyceric acid (CHEBI:17794) has functional parent D-glyceric acid (CHEBI:32398) |
| 3-phospho-D-glyceroyl dihydrogen phosphate (CHEBI:16001) has functional parent D-glyceric acid (CHEBI:32398) |
| cyclic 2,3-bisphospho-D-glyceric acid (CHEBI:28699) has functional parent D-glyceric acid (CHEBI:32398) |
| largamide D (CHEBI:66547) has functional parent D-glyceric acid (CHEBI:32398) |
| largamide E (CHEBI:66550) has functional parent D-glyceric acid (CHEBI:32398) |
| largamide F (CHEBI:66551) has functional parent D-glyceric acid (CHEBI:32398) |
| largamide G (CHEBI:66552) has functional parent D-glyceric acid (CHEBI:32398) |
| α-D-GlcpNAc-(1→3)-[P-6-[CH2]5NH2]-α-D-GlcpNAc-(1→2)-D-GroA (CHEBI:134200) has functional parent D-glyceric acid (CHEBI:32398) |
| D-glycerate (CHEBI:16659) is conjugate base of D-glyceric acid (CHEBI:32398) |
| L-glyceric acid (CHEBI:74324) is enantiomer of D-glyceric acid (CHEBI:32398) |
| IUPAC Name |
|---|
| (2R)-2,3-dihydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| Glyceric acid | KEGG COMPOUND |
| R-glyceric acid | ChEBI |
| D-Glyceric acid | HMDB |
| D-GroA | ChEBI |
| α,β-Hydroxypropionic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00001185 | KNApSAcK |
| C00258 | KEGG COMPOUND |
| DGY | PDBeChem |
| ECMDB04077 | ECMDB |
| GLYCERATE | MetaCyc |
| HMDB0000139 | HMDB |
| JP2009153507 | Patent |
| JP2009159826 | Patent |
| YMDB02299 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721418 | Reaxys |
| CAS:473-81-4 | KEGG COMPOUND |
| Citations |
|---|