EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28699 - cyclic 2,3-bisphospho-D-glyceric acid
| Formula | C3H6O9P2 |
| Net Charge | 0 |
| Average Mass | 248.020 |
| Monoisotopic Mass | 247.94871 |
| SMILES | O=C(O)[C@H]1COP(=O)(O)OP(=O)(O)O1 |
| InChI | InChI=1S/C3H6O9P2/c4-3(5)2-1-10-13(6,7)12-14(8,9)11-2/h2H,1H2,(H,4,5)(H,6,7)(H,8,9)/t2-/m1/s1 |
| InChIKey | PZJOIILIPTVGFU-UWTATZPHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclic 2,3-bisphospho-D-glyceric acid (CHEBI:28699) has functional parent D-glyceric acid (CHEBI:32398) |
| cyclic 2,3-bisphospho-D-glyceric acid (CHEBI:28699) is a bisphosphoglyceric acid (CHEBI:22902) |
| cyclic 2,3-bisphospho-D-glyceric acid (CHEBI:28699) is conjugate acid of cyclic 2,3-bisphospho-D-glycerate(3−) (CHEBI:79081) |
| Incoming Relation(s) |
| cyclic 2,3-bisphospho-D-glycerate(3−) (CHEBI:79081) is conjugate base of cyclic 2,3-bisphospho-D-glyceric acid (CHEBI:28699) |
| IUPAC Name |
|---|
| (6R)-2,4-dihydroxy-1,3,5,2,4-trioxadiphosphepane-6-carboxylic acid 2,4-dioxide |
| Synonyms | Source |
|---|---|
| 2,3-Cpp | ChemIDplus |
| 2,3-Cyclopyrophosphoglycerate | ChemIDplus |
| cDPG | KEGG COMPOUND |
| Cycl dpg | ChemIDplus |
| Cyclic 2,3-bisphospho-D-glycerate | KEGG COMPOUND |
| Cyclic 2,3-diphospho-D-glycerate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:88280-54-0 | ChemIDplus |