EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O4 |
| Net Charge | 0 |
| Average Mass | 106.077 |
| Monoisotopic Mass | 106.02661 |
| SMILES | O=C(O)[C@@H](O)CO |
| InChI | InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-/m0/s1 |
| InChIKey | RBNPOMFGQQGHHO-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glyceric acid (CHEBI:74324) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| L-glyceric acid (CHEBI:74324) is a glyceric acid (CHEBI:33508) |
| L-glyceric acid (CHEBI:74324) is enantiomer of D-glyceric acid (CHEBI:32398) |
| Incoming Relation(s) |
| D-glyceric acid (CHEBI:32398) is enantiomer of L-glyceric acid (CHEBI:74324) |
| IUPAC Name |
|---|
| (2S)-2,3-dihydroxypropanoic acid |
| Synonym | Source |
|---|---|
| (S)-Glyceric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006372 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721419 | Reaxys |
| CAS:28305-26-2 | ChemIDplus |