EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O9 |
| Net Charge | 0 |
| Average Mass | 268.218 |
| Monoisotopic Mass | 268.07943 |
| SMILES | O=C(O)[C@@H](CO)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O9/c10-1-3-5(12)6(13)7(14)9(17-3)18-4(2-11)8(15)16/h3-7,9-14H,1-2H2,(H,15,16)/t3-,4-,5-,6+,7-,9-/m1/s1 |
| InChIKey | DDXCFDOPXBPUJC-CECBSOHTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-(α-D-glucopyranosyl)-D-glyceric acid (CHEBI:62509) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-(α-D-glucopyranosyl)-D-glyceric acid (CHEBI:62509) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 2-O-(α-D-glucopyranosyl)-D-glyceric acid (CHEBI:62509) is a α-D-glucoside (CHEBI:22390) |
| 2-O-(α-D-glucopyranosyl)-D-glyceric acid (CHEBI:62509) is conjugate acid of 2-O-(α-D-glucopyranosyl)-D-glycerate (CHEBI:62510) |
| Incoming Relation(s) |
| 2-O-(α-D-glucopyranosyl)-D-glycerate (CHEBI:62510) is conjugate base of 2-O-(α-D-glucopyranosyl)-D-glyceric acid (CHEBI:62509) |
| IUPAC Name |
|---|
| (2R)-2-(α-D-glucopyranosyloxy)-3-hydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| O-α-D-glucopyranosyl-(1→2)-D-glyceric acid | ChEBI |
| (R)-2-O-α-D-glucopyranosyl glyceric acid | ChEBI |
| D-glyceric acid 2-O-(α-D-glucopyranoside) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1651027 | Reaxys |
| Citations |
|---|