EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8O10P2 |
| Net Charge | 0 |
| Average Mass | 266.035 |
| Monoisotopic Mass | 265.95927 |
| SMILES | O=C(O)[C@@H](COP(=O)(O)O)OP(=O)(O)O |
| InChI | InChI=1S/C3H8O10P2/c4-3(5)2(13-15(9,10)11)1-12-14(6,7)8/h2H,1H2,(H,4,5)(H2,6,7,8)(H2,9,10,11)/t2-/m1/s1 |
| InChIKey | XOHUEYCVLUUEJJ-UWTATZPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood (UBERON:0000178) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 165-177. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp., Basel, Switzerland c1981-1992.) | ||
| cytoplasm (GO:0005737) | PubMed (15882454) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-bisphospho-D-glyceric acid (CHEBI:17720) has functional parent D-glyceric acid (CHEBI:32398) |
| 2,3-bisphospho-D-glyceric acid (CHEBI:17720) has role human blood serum metabolite (CHEBI:85234) |
| 2,3-bisphospho-D-glyceric acid (CHEBI:17720) has role mouse metabolite (CHEBI:75771) |
| 2,3-bisphospho-D-glyceric acid (CHEBI:17720) is a 2,3-bisphosphoglyceric acid (CHEBI:28907) |
| 2,3-bisphospho-D-glyceric acid (CHEBI:17720) is conjugate acid of 2,3-bisphosphonato-D-glycerate(5−) (CHEBI:58248) |
| Incoming Relation(s) |
| 2,3-bisphosphonato-D-glycerate(5−) (CHEBI:58248) is conjugate base of 2,3-bisphospho-D-glyceric acid (CHEBI:17720) |
| IUPAC Name |
|---|
| (2R)-2,3-bis(phosphonooxy)propanoic acid |
| Synonyms | Source |
|---|---|
| 2,3-bisphospho-D-glycerate | ChEBI |
| 2,3-Bisphospho-D-glycerate | KEGG COMPOUND |
| 2,3-Bisphosphoglyceric acid | HMDB |
| 2,3-BPG | HMDB |
| 2,3-diphosphoglyceric acid | HMDB |
| 2,3-disphospho-D-glycerate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 23-DIPHOSPHOGLYCERATE | MetaCyc |
| C01159 | KEGG COMPOUND |
| DG2 | PDBeChem |
| HMDB0001294 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729440 | Reaxys |
| CAS:138-81-8 | ChemIDplus |
| Citations |
|---|