EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O14 |
| Net Charge | 0 |
| Average Mass | 430.359 |
| Monoisotopic Mass | 430.13226 |
| SMILES | O=C(O)[C@@H](CO)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H26O14/c16-1-4-7(19)9(21)11(23)14(26-4)29-12-10(22)8(20)5(2-17)27-15(12)28-6(3-18)13(24)25/h4-12,14-23H,1-3H2,(H,24,25)/t4-,5-,6-,7-,8-,9+,10+,11+,12-,14-,15-/m1/s1 |
| InChIKey | YYJFQOMCNVLANJ-MQZSKFSESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrotoga mobilis (ncbitaxon:69499) | - | PubMed (20061481) | |
| Rhodopirellula baltica (ncbitaxon:265606) | - | PubMed (23826385) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) has role bacterial metabolite (CHEBI:76969) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) has role marine metabolite (CHEBI:76507) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) is a disaccharide derivative (CHEBI:63353) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) is a glycoside (CHEBI:24400) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) is conjugate acid of 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glycerate (CHEBI:87836) |
| Incoming Relation(s) |
| 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glycerate (CHEBI:87836) is conjugate base of 2-O-[α-D-mannosyl-(1→2)-α-D-glucosyl]-D-glyceric acid (CHEBI:88152) |
| IUPAC Name |
|---|
| (2R)-3-hydroxy-2-[(α-D-mannopyranosyl-(1→2)-α-D-glucopyranosyl)oxy]propanoic acid |
| Synonyms | Source |
|---|---|
| 2-O-[α-D-mannopyranosyl-(1→2)-α-D-glucopyranosyl]-3-D-glyceric acid | ChEBI |
| (2R)-3-hydroxy-2-[(2-O-α-D-mannopyranosyl-α-D-glucopyranosyl)oxy]propanoic acid | IUPAC |
| mannosylglucosylglyceric acid | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-13015 | MetaCyc |
| Citations |
|---|