EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H82BrN9O17 |
| Net Charge | 0 |
| Average Mass | 1281.266 |
| Monoisotopic Mass | 1279.50120 |
| SMILES | [H][C@]12CC[C@@H](O)N(C1=O)[C@@]([H])([C@H](C)O)C(=O)N(C)[C@@H](Cc1ccc(O)c(Br)c1)C(=O)N[C@@H](C(C)C)C(=O)O[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCCc1ccc(O)cc1)NC(=O)[C@H](O)CO)C(C)C)C(=O)N[C@@H](Cc1ccc(C)cc1)C(=O)N2 |
| InChI | InChI=1S/C60H82BrN9O17/c1-29(2)47(66-51(77)32(6)62-52(78)40(63-55(81)45(75)28-71)12-10-11-35-17-20-38(73)21-18-35)56(82)68-49-34(8)87-60(86)48(30(3)4)67-54(80)43(27-37-19-23-44(74)39(61)25-37)69(9)59(85)50(33(7)72)70-46(76)24-22-41(58(70)84)64-53(79)42(65-57(49)83)26-36-15-13-31(5)14-16-36/h13-21,23,25,29-30,32-34,40-43,45-50,71-76H,10-12,22,24,26-28H2,1-9H3,(H,62,78)(H,63,81)(H,64,79)(H,65,83)(H,66,77)(H,67,80)(H,68,82)/t32-,33-,34+,40-,41-,42-,43-,45+,46+,47-,48-,49-,50-/m0/s1 |
| InChIKey | RHQKNCSUWKVICI-JLENUOFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (16930043) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| largamide F (CHEBI:66551) has functional parent D-glyceric acid (CHEBI:32398) |
| largamide F (CHEBI:66551) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| largamide F (CHEBI:66551) has role metabolite (CHEBI:25212) |
| largamide F (CHEBI:66551) is a cyclodepsipeptide (CHEBI:35213) |
| largamide F (CHEBI:66551) is a macrocycle (CHEBI:51026) |
| largamide F (CHEBI:66551) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| N-[(2R)-2,3-dihydroxypropanoyl]-5-(4-hydroxyphenyl)-L-norvalyl-L-alanyl-N-[(2S,5S,8S,11R,12S,15S,18S,21R)-5-(3-bromo-4-hydroxybenzyl)-21-hydroxy-2-[(1S)-1-hydroxyethyl]-4,11-dimethyl-15-(4-methylbenzyl)-3,6,9,13,16,22-hexaoxo-8-(propan-2-yl)-10-oxa-1,4,7,14,17-pentaazabicyclo[16.3.1]docos-12-yl]-L-valinamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10642969 | Reaxys |
| Citations |
|---|