EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H82BrN9O18 |
| Net Charge | 0 |
| Average Mass | 1297.265 |
| Monoisotopic Mass | 1295.49612 |
| SMILES | [H][C@]12CC[C@@H](O)N(C1=O)[C@@]([H])([C@H](C)O)C(=O)N(C)[C@@H](Cc1ccc(O)c(Br)c1)C(=O)N[C@@H](C(C)C)C(=O)O[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCCc1ccc(O)cc1)NC(=O)[C@H](O)CO)C(C)C)C(=O)N[C@@H](CCc1ccc(O)cc1)C(=O)N2 |
| InChI | InChI=1S/C60H82BrN9O18/c1-29(2)47(66-51(78)31(5)62-52(79)40(63-55(82)45(76)28-71)11-9-10-34-12-18-37(73)19-13-34)56(83)68-49-33(7)88-60(87)48(30(3)4)67-54(81)43(27-36-17-24-44(75)39(61)26-36)69(8)59(86)50(32(6)72)70-46(77)25-23-42(58(70)85)65-53(80)41(64-57(49)84)22-16-35-14-20-38(74)21-15-35/h12-15,17-21,24,26,29-33,40-43,45-50,71-77H,9-11,16,22-23,25,27-28H2,1-8H3,(H,62,79)(H,63,82)(H,64,84)(H,65,80)(H,66,78)(H,67,81)(H,68,83)/t31-,32-,33+,40-,41-,42-,43-,45+,46+,47-,48-,49-,50-/m0/s1 |
| InChIKey | TUWXFKMBPYEGHC-BYVKOCPSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (16930043) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| largamide G (CHEBI:66552) has functional parent D-glyceric acid (CHEBI:32398) |
| largamide G (CHEBI:66552) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| largamide G (CHEBI:66552) has role metabolite (CHEBI:25212) |
| largamide G (CHEBI:66552) is a cyclodepsipeptide (CHEBI:35213) |
| largamide G (CHEBI:66552) is a macrocycle (CHEBI:51026) |
| largamide G (CHEBI:66552) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| N-[(2R)-2,3-dihydroxypropanoyl]-5-(4-hydroxyphenyl)-L-norvalyl-L-alanyl-N-[(2S,5S,8S,11R,12S,15S,18S,21R)-5-(3-bromo-4-hydroxybenzyl)-21-hydroxy-2-[(1S)-1-hydroxyethyl]-4,11-dimethyl-15-[2-(4-hydroxyphenyl)ethyl]-3,6,9,13,16,22-hexaoxo-8-(propan-2-yl)-10-oxa-1,4,7,14,17-pentaazabicyclo[16.3.1]docos-12-yl]-L-valinamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10643043 | Reaxys |
| Citations |
|---|