EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:137558 - 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid
| Formula | C15H26O14 |
| Net Charge | 0 |
| Average Mass | 430.359 |
| Monoisotopic Mass | 430.13226 |
| SMILES | O=C(O)[C@@H](CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H26O14/c16-1-4-7(18)9(20)11(22)14(27-4)26-3-6-8(19)10(21)12(23)15(29-6)28-5(2-17)13(24)25/h4-12,14-23H,1-3H2,(H,24,25)/t4-,5-,6-,7-,8-,9+,10+,11-,12-,14+,15+/m1/s1 |
| InChIKey | DMTGFWVSBPXWQU-MJPWOAHQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid (CHEBI:137558) has functional parent D-glyceric acid (CHEBI:32398) |
| 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid (CHEBI:137558) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid (CHEBI:137558) is a disaccharide derivative (CHEBI:63353) |
| 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid (CHEBI:137558) is a glycoside (CHEBI:24400) |
| 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid (CHEBI:137558) is conjugate acid of 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glycerate (CHEBI:136742) |
| Incoming Relation(s) |
| 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glycerate (CHEBI:136742) is conjugate base of 2-O-[α-D-glucosyl-(1→6)-α-D-glucosyl]-D-glyceric acid (CHEBI:137558) |
| IUPAC Name |
|---|
| (2R)-2-[(6-O-α-D-glucopyranosyl-α-D-glucopyranosyl)oxy]-3-hydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| 2-O-[α-D-glucopyranosyl-(1→6)-α-D-glucopyranosyl]-D-glyceric acid | ChEBI |
| diglucosylglyceric acid | ChEBI |
| Citations |
|---|