EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O3 |
| Net Charge | 0 |
| Average Mass | 210.273 |
| Monoisotopic Mass | 210.12559 |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CC(=O)O |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1 |
| InChIKey | ZNJFBWYDHIGLCU-HWKXXFMVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jasmonic acid (CHEBI:18292) has role jasmonates (CHEBI:24937) |
| jasmonic acid (CHEBI:18292) has role plant metabolite (CHEBI:76924) |
| jasmonic acid (CHEBI:18292) is a oxo monocarboxylic acid (CHEBI:35871) |
| jasmonic acid (CHEBI:18292) is conjugate acid of jasmonate(1−) (CHEBI:58431) |
| jasmonic acid (CHEBI:18292) is enantiomer of (+)-jasmonic acid (CHEBI:139300) |
| Incoming Relation(s) |
| (-)-7-epi--9,10-dihydrojasmonic acid (CHEBI:180007) has functional parent jasmonic acid (CHEBI:18292) |
| (-)-8-hydroxyjasmonic acid (CHEBI:210271) has functional parent jasmonic acid (CHEBI:18292) |
| (+)-7-epi--9,10-dihydrojasmonic acid (CHEBI:180008) has functional parent jasmonic acid (CHEBI:18292) |
| (+)-cucurbic acid (CHEBI:18446) has functional parent jasmonic acid (CHEBI:18292) |
| (3S,7R)-iso-jasmonic acid (CHEBI:184618) has functional parent jasmonic acid (CHEBI:18292) |
| 12-hydroxyjasmonic acid (CHEBI:37420) has functional parent jasmonic acid (CHEBI:18292) |
| 2-(3-Oxo-2-pent-2-enylcyclopentyl)acetic acid (CHEBI:182634) has functional parent jasmonic acid (CHEBI:18292) |
| 7-iso-cucurbic acid (CHEBI:227715) has functional parent jasmonic acid (CHEBI:18292) |
| 9,10-Dihydrojasmonic acid (CHEBI:177664) has functional parent jasmonic acid (CHEBI:18292) |
| dihydrojasmonic acid (CHEBI:23747) has functional parent jasmonic acid (CHEBI:18292) |
| Epi-4'-hydroxyjasmonic acid (CHEBI:165792) has functional parent jasmonic acid (CHEBI:18292) |
| jasmonate ester (CHEBI:52464) has functional parent jasmonic acid (CHEBI:18292) |
| Lasiojasmonate A (CHEBI:198084) has functional parent jasmonic acid (CHEBI:18292) |
| Lasiojasmonate B (CHEBI:217083) has functional parent jasmonic acid (CHEBI:18292) |
| Lasiojasmonate C (CHEBI:201889) has functional parent jasmonic acid (CHEBI:18292) |
| MeJA (CHEBI:189436) has functional parent jasmonic acid (CHEBI:18292) |
| methyl 2-(3-oxo-2-pentylcyclopentyl)acetate (CHEBI:195265) has functional parent jasmonic acid (CHEBI:18292) |
| Methyl dihydrojasmonate (CHEBI:89741) has functional parent jasmonic acid (CHEBI:18292) |
| Prohydrojasmon (CHEBI:81814) has functional parent jasmonic acid (CHEBI:18292) |
| jasmonate(1−) (CHEBI:58431) is conjugate base of jasmonic acid (CHEBI:18292) |
| (+)-jasmonic acid (CHEBI:139300) is enantiomer of jasmonic acid (CHEBI:18292) |
| IUPAC Name |
|---|
| {(1R,2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetic acid |
| Synonyms | Source |
|---|---|
| (1R,2R)-3-oxo-2-(2Z)-2-penten-ylcyclopentanacetic acid | ChEBI |
| (1R,2R)-3-oxo-2-(pent-2Z-enyl)-cyclopentaneacetic acid | LIPID MAPS |
| 2-{(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl}acetate | IUBMB |
| Jasmonate | KEGG COMPOUND |
| (-)-jasmonic acid | ChEBI |
| (-)-Jasmonic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2440 | BPDB |
| 4444606 | ChemSpider |
| C00000218 | KNApSAcK |
| C08491 | KEGG COMPOUND |
| FDB015493 | FooDB |
| HMDB0032797 | HMDB |
| JAA | PDBeChem |
| Jasmonic_acid | Wikipedia |
| LMFA02020001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2692609 | Reaxys |
| CAS:6894-38-8 | ChemIDplus |
| CAS:6894-38-8 | KEGG COMPOUND |
| Citations |
|---|