EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O3 |
| Net Charge | 0 |
| Average Mass | 224.300 |
| Monoisotopic Mass | 224.14124 |
| SMILES | CC/C=C\CC1C(=O)CCC1CC(=O)OC |
| InChI | InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4- |
| InChIKey | GEWDNTWNSAZUDX-PLNGDYQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | guard cell (BTO:0000544) | MetaboLights (MTBLS1326) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MeJA (CHEBI:189436) has functional parent jasmonic acid (CHEBI:18292) |
| MeJA (CHEBI:189436) is a Jasmonate derivatives (CHEBI:167055) |
| IUPAC Name |
|---|
| methyl 2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| Manual Xrefs | Databases |
|---|---|
| 4477936 | ChemSpider |