EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O4 |
| Net Charge | 0 |
| Average Mass | 226.272 |
| Monoisotopic Mass | 226.12051 |
| SMILES | CC(O)/C=C\C[C@H]1C(=O)CC[C@H]1CC(=O)O |
| InChI | InChI=1S/C12H18O4/c1-8(13)3-2-4-10-9(7-12(15)16)5-6-11(10)14/h2-3,8-10,13H,4-7H2,1H3,(H,15,16)/b3-2-/t8?,9-,10+/m0/s1 |
| InChIKey | KLPBEXRQJBKPDM-VFERKYTESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epi-4'-hydroxyjasmonic acid (CHEBI:165792) has functional parent jasmonic acid (CHEBI:18292) |
| Epi-4'-hydroxyjasmonic acid (CHEBI:165792) is a Jasmonate derivatives (CHEBI:167055) |
| IUPAC Name |
|---|
| 2-[(1S,2R)-2-[(Z)-4-hydroxypent-2-enyl]-3-oxocyclopentyl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 17220768 | ChemSpider |
| LMFA02020008 | LIPID MAPS |