EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O3 |
| Net Charge | 0 |
| Average Mass | 226.316 |
| Monoisotopic Mass | 226.15689 |
| SMILES | CCCCC[C@H]1C(=O)CC[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | KVWWIYGFBYDJQC-GHMZBOCLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (20809147) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl dihydrojasmonate (CHEBI:89741) has functional parent jasmonic acid (CHEBI:18292) |
| Methyl dihydrojasmonate (CHEBI:89741) is a Jasmonate derivatives (CHEBI:167055) |
| Synonyms | Source |
|---|---|
| (1R,2R)-Methyl dihydrojasmonate | HMDB |
| Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester | HMDB |
| Dihydrojasmonic acid methyl ester | HMDB |
| FEMA 3408 | HMDB |
| Hedione | HMDB |
| Kharismal | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031740 | HMDB |
| Methyl_dihydrojasmonate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:24851-98-7 | KEGG COMPOUND |
| Citations |
|---|