EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O4 |
| Net Charge | 0 |
| Average Mass | 226.272 |
| Monoisotopic Mass | 226.12051 |
| SMILES | O=C(O)C[C@H]1CCC(=O)[C@@H]1C/C=C\CCO |
| InChI | InChI=1S/C12H18O4/c13-7-3-1-2-4-10-9(8-12(15)16)5-6-11(10)14/h1-2,9-10,13H,3-8H2,(H,15,16)/b2-1-/t9-,10-/m1/s1 |
| InChIKey | RZGFUGXQKMEMOO-BSANDHCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (12637544) | |
| Magnaporthe oryzae (ncbitaxon:318829) | - | PubMed (26258762) | |
| Origanum dictamnus (ncbitaxon:497761) | - | PubMed (20423097) | |
| Origanum vulgare subsp. hirtum (ncbitaxon:497766) | - | PubMed (16249088) | |
| Samanea saman (ncbitaxon:76910) | - | PubMed (21228101) | |
| Solanum tuberosum (ncbitaxon:4113) | - | PubMed (15666542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-hydroxyjasmonic acid (CHEBI:37420) has functional parent jasmonic acid (CHEBI:18292) |
| 12-hydroxyjasmonic acid (CHEBI:37420) has role plant metabolite (CHEBI:76924) |
| 12-hydroxyjasmonic acid (CHEBI:37420) is a cyclopentanones (CHEBI:36140) |
| 12-hydroxyjasmonic acid (CHEBI:37420) is a homoallylic alcohol (CHEBI:134362) |
| 12-hydroxyjasmonic acid (CHEBI:37420) is a olefinic compound (CHEBI:78840) |
| 12-hydroxyjasmonic acid (CHEBI:37420) is a oxo carboxylic acid (CHEBI:25754) |
| 12-hydroxyjasmonic acid (CHEBI:37420) is a primary alcohol (CHEBI:15734) |
| 12-hydroxyjasmonic acid (CHEBI:37420) is conjugate acid of 12-hydroxyjasmonate (CHEBI:132022) |
| Incoming Relation(s) |
| 12-hydroxyjasmonic acid 12-O-β-D-glucoside (CHEBI:37419) has functional parent 12-hydroxyjasmonic acid (CHEBI:37420) |
| 12-hydroxyjasmonate (CHEBI:132022) is conjugate base of 12-hydroxyjasmonic acid (CHEBI:37420) |
| IUPAC Name |
|---|
| {(1R,2R)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl}acetic acid |
| Synonyms | Source |
|---|---|
| (−)-12-hydroxyjasmonic acid | LIPID MAPS |
| 12OH-JA | ChEBI |
| (1R,2R)-12-hydroxyjasmonic acid | LIPID MAPS |
| tuberonic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00000233 | KNApSAcK |
| CPD-11253 | MetaCyc |
| LMFA02020011 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5002681 | Reaxys |
| Beilstein:5334635 | Beilstein |
| Citations |
|---|