EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O3 |
| Net Charge | 0 |
| Average Mass | 210.273 |
| Monoisotopic Mass | 210.12559 |
| SMILES | CC/C=C\C[C@@H]1C(=O)CC[C@H]1CC(=O)O |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m0/s1 |
| InChIKey | ZNJFBWYDHIGLCU-CMIOBCHKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-jasmonic acid (CHEBI:139300) has role jasmonates (CHEBI:24937) |
| (+)-jasmonic acid (CHEBI:139300) is a cyclopentanones (CHEBI:36140) |
| (+)-jasmonic acid (CHEBI:139300) is a oxo monocarboxylic acid (CHEBI:35871) |
| (+)-jasmonic acid (CHEBI:139300) is conjugate acid of (+)-jasmonic acid anion (CHEBI:138625) |
| (+)-jasmonic acid (CHEBI:139300) is enantiomer of jasmonic acid (CHEBI:18292) |
| Incoming Relation(s) |
| (+)-jasmonic acid anion (CHEBI:138625) is conjugate base of (+)-jasmonic acid (CHEBI:139300) |
| jasmonic acid (CHEBI:18292) is enantiomer of (+)-jasmonic acid (CHEBI:139300) |
| IUPAC Name |
|---|
| {(1S,2S)-3-oxo-2-[(2 Z)-pent-2-en-1-yl]cyclopentyl}acetic acid |
| Synonym | Source |
|---|---|
| (1S,2S)-jasmonic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2415413 | Reaxys |