EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O3 |
| Net Charge | 0 |
| Average Mass | 210.273 |
| Monoisotopic Mass | 210.12559 |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@H]1CC(=O)O |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+/m0/s1 |
| InChIKey | ZNJFBWYDHIGLCU-RWCMCFKCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,7R)-iso-jasmonic acid (CHEBI:184618) has functional parent jasmonic acid (CHEBI:18292) |
| (3S,7R)-iso-jasmonic acid (CHEBI:184618) is a Jasmonate derivatives (CHEBI:167055) |
| (3S,7R)-iso-jasmonic acid (CHEBI:184618) is a oxo monocarboxylic acid (CHEBI:35871) |
| IUPAC Name |
|---|
| 2-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 5584833 | ChemSpider |
| LMFA02020004 | LIPID MAPS |