EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O3 |
| Net Charge | 0 |
| Average Mass | 212.289 |
| Monoisotopic Mass | 212.14124 |
| SMILES | CCCCCC1C(=O)CCC1CC(=O)O |
| InChI | InChI=1S/C12H20O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h9-10H,2-8H2,1H3,(H,14,15) |
| InChIKey | PQEYTAGBXNEUQL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-Dihydrojasmonic acid (CHEBI:177664) has functional parent jasmonic acid (CHEBI:18292) |
| 9,10-Dihydrojasmonic acid (CHEBI:177664) is a Jasmonate derivatives (CHEBI:167055) |
| IUPAC Name |
|---|
| 2-(3-oxo-2-pentylcyclopentyl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 96397 | ChemSpider |
| HMDB0033601 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:3572-64-3 | ChemIDplus |