EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O3 |
| Net Charge | 0 |
| Average Mass | 212.289 |
| Monoisotopic Mass | 212.14124 |
| SMILES | CC/C=C\C[C@H]1[C@@H](CC(=O)O)CC[C@@H]1O |
| InChI | InChI=1S/C12H20O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-11,13H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+,11+/m1/s1 |
| InChIKey | LYSGIJUGUGJIPS-UOMVISFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-cucurbic acid (CHEBI:18446) has functional parent jasmonic acid (CHEBI:18292) |
| (+)-cucurbic acid (CHEBI:18446) has role jasmonates (CHEBI:24937) |
| (+)-cucurbic acid (CHEBI:18446) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| {(1R,2S,3S)-3-hydroxy-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetic acid |
| Synonym | Source |
|---|---|
| (3R,6S,7S)-cucurbic acid | ChEBI |