EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O4S |
| Net Charge | 0 |
| Average Mass | 334.397 |
| Monoisotopic Mass | 334.09873 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t11-,12+,14-/m1/s1 |
| InChIKey | JGSARLDLIJGVTE-MBNYWOFBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. drug allergen Any drug which causes the onset of an allergic reaction. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicillin (CHEBI:18208) has role antibacterial drug (CHEBI:36047) |
| benzylpenicillin (CHEBI:18208) has role drug allergen (CHEBI:88188) |
| benzylpenicillin (CHEBI:18208) has role epitope (CHEBI:53000) |
| benzylpenicillin (CHEBI:18208) is a penicillin (CHEBI:17334) |
| benzylpenicillin (CHEBI:18208) is a penicillin allergen (CHEBI:88187) |
| benzylpenicillin (CHEBI:18208) is conjugate acid of benzylpenicillin(1−) (CHEBI:51354) |
| Incoming Relation(s) |
| benzylpenicilloyl polylysine (CHEBI:59297) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl-L-lysine (CHEBI:139367) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl-benzylamine (CHEBI:42719) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl-butylamine (CHEBI:55472) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl-cysteine (CHEBI:60178) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl-octa-L-lysine (CHEBI:133956) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenilloic acid (CHEBI:139245) has functional parent benzylpenicillin (CHEBI:18208) |
| DON-15-penicillin G (CHEBI:149460) has functional parent benzylpenicillin (CHEBI:18208) |
| penamecillin (CHEBI:131733) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicillin(1−) (CHEBI:51354) is conjugate base of benzylpenicillin (CHEBI:18208) |
| benzylpenamaldate group (CHEBI:139234) is substituent group from benzylpenicillin (CHEBI:18208) |
| benzylpenamidyl group (CHEBI:139225) is substituent group from benzylpenicillin (CHEBI:18208) |
| benzylpenicanyl group (CHEBI:139229) is substituent group from benzylpenicillin (CHEBI:18208) |
| benzylpenicillanyl group (CHEBI:53600) is substituent group from benzylpenicillin (CHEBI:18208) |
| benzylpenicillenyl group (CHEBI:139227) is substituent group from benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl group (CHEBI:53702) is substituent group from benzylpenicillin (CHEBI:18208) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-(phenylacetamido)penam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| bencilpenicilina | ChemIDplus |
| benzylpenicillin | KEGG DRUG |
| benzylpénicilline | ChemIDplus |
| benzylpenicillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-(phenylacetamido)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | ChEBI |
| 6-(2-phenylacetamido)penicillanic acid | ChemIDplus |
| bensylpenicillin | ChEBI |
| benzyl benicillin | ChEBI |
| Benzylpenicillin | KEGG COMPOUND |
| benzylpenicillinic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2082 | DrugCentral |
| Benzylpenicillin | Wikipedia |
| C05551 | KEGG COMPOUND |
| D02336 | KEGG DRUG |
| DB01053 | DrugBank |
| HMDB0015186 | HMDB |
| LSM-3229 | LINCS |
| PNN | PDBeChem |
| US3024169 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:44740 | Reaxys |
| Gmelin:781913 | Gmelin |
| CAS:61-33-6 | KEGG COMPOUND |
| CAS:61-33-6 | ChemIDplus |
| Citations |
|---|