EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N3O4S |
| Net Charge | 0 |
| Average Mass | 407.536 |
| Monoisotopic Mass | 407.18788 |
| SMILES | [H][C@@]1([C@H](NC(=O)Cc2ccccc2)C(=O)NCCCC)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C20H29N3O4S/c1-4-5-11-21-17(25)15(18-23-16(19(26)27)20(2,3)28-18)22-14(24)12-13-9-7-6-8-10-13/h6-10,15-16,18,23H,4-5,11-12H2,1-3H3,(H,21,25)(H,22,24)(H,26,27)/t15-,16+,18-/m1/s1 |
| InChIKey | QRLSGQYOHPQEPE-SOLBZPMBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicilloyl-butylamine (CHEBI:55472) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl-butylamine (CHEBI:55472) is a monocarboxylic acid amide (CHEBI:29347) |
| benzylpenicilloyl-butylamine (CHEBI:55472) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| benzylpenicilloyl-butylamine (CHEBI:55472) is conjugate acid of benzylpenicilloyl-butylamine(1−) (CHEBI:176775) |
| Incoming Relation(s) |
| benzylpenicilloyl-butylamine(1−) (CHEBI:176775) is conjugate base of benzylpenicilloyl-butylamine (CHEBI:55472) |
| IUPAC Name |
|---|
| (2R,4S)-2-{(1R)-2-(butylamino)-2-oxo-1-[(phenylacetyl)amino]ethyl}-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| (5R,6R)-Bu-BPO | ChEBI |
| benzylpenicilloyl butylamine | ChEBI |
| BPO-BA | ChEBI |
| BPO-butylamine | ChEBI |
| Citations |
|---|