EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N3O6S2 |
| Net Charge | 0 |
| Average Mass | 455.558 |
| Monoisotopic Mass | 455.11848 |
| SMILES | [H][C@@]1([C@H](NC(=O)Cc2ccccc2)C(=O)N[C@@H](CS)C(=O)O)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C19H25N3O6S2/c1-19(2)14(18(27)28)22-16(30-19)13(15(24)20-11(9-29)17(25)26)21-12(23)8-10-6-4-3-5-7-10/h3-7,11,13-14,16,22,29H,8-9H2,1-2H3,(H,20,24)(H,21,23)(H,25,26)(H,27,28)/t11-,13+,14-,16+/m0/s1 |
| InChIKey | ZKVQVUUPDWIKAR-ZGMNHVEMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicilloyl-cysteine (CHEBI:60178) has functional parent L-cysteine (CHEBI:17561) |
| benzylpenicilloyl-cysteine (CHEBI:60178) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl-cysteine (CHEBI:60178) is a dicarboxylic acid (CHEBI:35692) |
| benzylpenicilloyl-cysteine (CHEBI:60178) is a thiazolidinedicarboxylic acid (CHEBI:36176) |
| IUPAC Name |
|---|
| (2R,4S)-2-{(1R)-2-{[(1R)-1-carboxy-2-sulfanylethyl]amino}-2-oxo-1-[(phenylacetyl)amino]ethyl}-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| benzylpenicilloyl cysteine | ChEBI |
| cysteine derivative of benzylpenicillin | ChEBI |
| cysteine derivative of penicillin | ChEBI |
| PNCy | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:64275 | Reaxys |
| Citations |
|---|