EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N2O4S |
| Net Charge | 0 |
| Average Mass | 333.389 |
| Monoisotopic Mass | 333.09090 |
| SMILES | *SC(C)(C)C(N/C=C1/N=C(Cc2ccccc2)OC1=O)C(=O)O |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicillenyl group (CHEBI:139227) has role epitope (CHEBI:53000) |
| benzylpenicillenyl group (CHEBI:139227) is a penicillin-derived group (CHEBI:139226) |
| benzylpenicillenyl group (CHEBI:139227) is substituent group from benzylpenicillin (CHEBI:18208) |
| IUPAC Name |
|---|
| (1-{[(E)-(2-benzyl-5-oxo-1,3-oxazol-4(5H)-ylidene)methyl]amino}-1-carboxy-2-methylpropan-2-yl)sulfanediyl |
| Synonyms | Source |
|---|---|
| N-[(E)-(2-benzyl-5-oxo-1,3-oxazol-4(5H)-ylidene)methyl]-3,3-dimethylcystein-S-yl | ChEBI |
| penicillenyl G group | ChEBI |
| Citations |
|---|