EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131733 - penamecillin
| Formula | C19H22N2O6S |
| Net Charge | 0 |
| Average Mass | 406.460 |
| Monoisotopic Mass | 406.11986 |
| SMILES | [H][C@]12SC(C)(C)[C@]([H])(C(=O)OCOC(C)=O)N1C(=O)[C@@]2([H])NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O6S/c1-11(22)26-10-27-18(25)15-19(2,3)28-17-14(16(24)21(15)17)20-13(23)9-12-7-5-4-6-8-12/h4-8,14-15,17H,9-10H2,1-3H3,(H,20,23)/t14-,15+,17-/m1/s1 |
| InChIKey | NLOOMWLTUVBWAW-HLLBOEOZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penamecillin (CHEBI:131733) has functional parent benzylpenicillin (CHEBI:18208) |
| penamecillin (CHEBI:131733) has role antibacterial drug (CHEBI:36047) |
| penamecillin (CHEBI:131733) has role prodrug (CHEBI:50266) |
| penamecillin (CHEBI:131733) is a penicillanic acid ester (CHEBI:51212) |
| penamecillin (CHEBI:131733) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| acetoxymethyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-(2-phenylacetamido)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| INNs | Source |
|---|---|
| penamecilina | WHO MedNet |
| penamecillin | WHO MedNet |
| pénamécilline | WHO MedNet |
| penamecillinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Benzylpenicillin acetoxymethyl ester | ChemIDplus |
| Acetoxymethyl benzylpenicillanate | ChemIDplus |
| Citations |
|---|