EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51354 - benzylpenicillin(1−)
| Formula | C16H17N2O4S |
| Net Charge | -1 |
| Average Mass | 333.389 |
| Monoisotopic Mass | 333.09145 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/p-1/t11-,12+,14-/m1/s1 |
| InChIKey | JGSARLDLIJGVTE-MBNYWOFBSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicillin(1−) (CHEBI:51354) is a penicillinate anion (CHEBI:51356) |
| benzylpenicillin(1−) (CHEBI:51354) is conjugate base of benzylpenicillin (CHEBI:18208) |
| Incoming Relation(s) |
| benzylpenicillin benethamine (CHEBI:52151) has part benzylpenicillin(1−) (CHEBI:51354) |
| benzylpenicillin benzathine (CHEBI:51352) has part benzylpenicillin(1−) (CHEBI:51354) |
| benzylpenicillin clemizole (CHEBI:52139) has part benzylpenicillin(1−) (CHEBI:51354) |
| benzylpenicillin potassium (CHEBI:7963) has part benzylpenicillin(1−) (CHEBI:51354) |
| benzylpenicillin procaine (CHEBI:52154) has part benzylpenicillin(1−) (CHEBI:51354) |
| benzylpenicillin sodium (CHEBI:51765) has part benzylpenicillin(1−) (CHEBI:51354) |
| benzylpenicillin (CHEBI:18208) is conjugate acid of benzylpenicillin(1−) (CHEBI:51354) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-(phenylacetamido)penam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| UniProt Name | Source |
|---|---|
| penicillin G | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3915298 | Beilstein |