EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N2O3S |
| Net Charge | 0 |
| Average Mass | 308.403 |
| Monoisotopic Mass | 308.11946 |
| SMILES | [H][C@@]1(CNC(=O)Cc2ccccc2)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C15H20N2O3S/c1-15(2)13(14(19)20)17-12(21-15)9-16-11(18)8-10-6-4-3-5-7-10/h3-7,12-13,17H,8-9H2,1-2H3,(H,16,18)(H,19,20)/t12-,13+/m1/s1 |
| InChIKey | LRWFMQCGNBOTQP-OLZOCXBDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenilloic acid (CHEBI:139245) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenilloic acid (CHEBI:139245) has role epitope (CHEBI:53000) |
| benzylpenilloic acid (CHEBI:139245) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| IUPAC Name |
|---|
| (2R,4S)-5,5-dimethyl-2-[(2-phenylacetamido)methyl]-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| penilloic G acid | IUPAC |
| (5R,3S)-benzyl-D-penilloic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP0367090 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:90605 | Reaxys |
| Citations |
|---|