EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C22H30N4O5S)ran.(C6H12N2O)ran.H4O2 |
| Net Charge | 0 |
| Average Mass | 626.777 |
| Monoisotopic Mass | 626.30978 |
| SMILES | [H]N[C@H](CCCCN)C(=O)O.[H]N[C@H](CCCCNC(=O)C(NC(=O)Cc1ccccc1)[C@]1([H])N[C@@H](C(=O)O)C(C)(C)S1)C(=O)O |
| InChI | InChI=1S/C22H32N4O6S.C6H14N2O2/c1-22(2)17(21(31)32)26-19(33-22)16(25-15(27)12-13-8-4-3-5-9-13)18(28)24-11-7-6-10-14(23)20(29)30;7-4-2-1-3-5(8)6(9)10/h3-5,8-9,14,16-17,19,26H,6-7,10-12,23H2,1-2H3,(H,24,28)(H,25,27)(H,29,30)(H,31,32);5H,1-4,7-8H2,(H,9,10)/t14-,16?,17+,19-;5-/m11/s1 |
| InChIKey | IMPVZRLKKKXMKQ-SGDOCVTFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | diagnostic agent A substance administered to aid diagnosis of a disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicilloyl polylysine (CHEBI:59297) has functional parent benzylpenicillin (CHEBI:18208) |
| benzylpenicilloyl polylysine (CHEBI:59297) has role diagnostic agent (CHEBI:33295) |
| benzylpenicilloyl polylysine (CHEBI:59297) is a amino acid amide (CHEBI:22475) |
| benzylpenicilloyl polylysine (CHEBI:59297) is a polypeptide (CHEBI:15841) |
| benzylpenicilloyl polylysine (CHEBI:59297) is a random copolymer (CHEBI:53521) |
| benzylpenicilloyl polylysine (CHEBI:59297) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| Synonyms | Source |
|---|---|
| benzylpenicilloyl G polylysine | ChEBI |
| benzylpenicilloyl-polylysine | ChEBI |
| benzylpenicilloyl-poly-L-lysine | ChEBI |
| BPO-PLL | ChEBI |
| penicilloyl polylysine | ChemIDplus |
| Penicilloyl-polylysine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Benzylpenicilloyl_polylysine | Wikipedia |
| D03095 | KEGG DRUG |
| DB00895 | DrugBank |
| GB1226773 | Patent |
| US3979508 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29664743 | Reaxys |
| CAS:53608-77-8 | ChemIDplus |
| Citations |
|---|