EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N2O6S |
| Net Charge | 0 |
| Average Mass | 379.414 |
| Monoisotopic Mass | 379.09638 |
| SMILES | *C(=O)N1[C@@H](C(=O)O)C(C)(C)S[C@]1([H])[C@H](NC(=O)Cc1ccccc1)C(=O)O |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenamidyl group (CHEBI:139225) has role epitope (CHEBI:53000) |
| benzylpenamidyl group (CHEBI:139225) is a penicillin-derived group (CHEBI:139226) |
| benzylpenamidyl group (CHEBI:139225) is substituent group from benzylpenicillin (CHEBI:18208) |
| IUPAC Name |
|---|
| (2R,4S)-4-carboxy-2-[(R)-carboxy(2-phenylacetamido)methyl]-5,5-dimethyl-1,3-thiazolidine-3-carbonyl |
| Synonym | Source |
|---|---|
| penamidyl G group | ChEBI |
| Citations |
|---|