EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H29O14 |
| Net Charge | +1 |
| Average Mass | 625.559 |
| Monoisotopic Mass | 625.15518 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2O[C@H](COC(=O)/C=C\c3ccc(O)cc3)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c1O |
| InChI | InChI=1S/C31H28O14/c1-41-22-9-15(8-20(35)26(22)37)30-23(12-18-19(34)10-17(33)11-21(18)43-30)44-31-29(40)28(39)27(38)24(45-31)13-42-25(36)7-4-14-2-5-16(32)6-3-14/h2-12,24,27-29,31,38-40H,13H2,1H3,(H4-,32,33,34,35,36,37)/p+1/t24-,27-,28+,29-,31-/m1/s1 |
| InChIKey | KTFQEFWNLAUGAX-VEZAKBLNSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) has functional parent petunidin (CHEBI:75318) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) has role metabolite (CHEBI:25212) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) is a anthocyanin cation (CHEBI:35218) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) is a aromatic ether (CHEBI:35618) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) is a cinnamate ester (CHEBI:36087) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) is a polyphenol (CHEBI:26195) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromenium-3-yl 6-O-[(2Z)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| petunidin-3-O-(6-O-cis-p-coumaryl-β-D-glucoside) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9605416 | Reaxys |