EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O7 |
| Net Charge | 0 |
| Average Mass | 360.362 |
| Monoisotopic Mass | 360.12090 |
| SMILES | [H][C@]12[C@@H](C(=C)C=O)C[C@H](OC(=O)/C=C\c3ccc(O)cc3)[C@@]1(O)CO[C@@H]2O |
| InChI | InChI=1S/C19H20O7/c1-11(9-20)14-8-15(19(24)10-25-18(23)17(14)19)26-16(22)7-4-12-2-5-13(21)6-3-12/h2-7,9,14-15,17-18,21,23-24H,1,8,10H2/b7-4-/t14-,15+,17-,18+,19+/m1/s1 |
| InChIKey | HJTBDPQCVMXWMZ-FESMDYCJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Viburnum luzonicum (IPNI:149799-1) | leaf (BTO:0000713) | PubMed (15635247) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luzonial B (CHEBI:66599) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| luzonial B (CHEBI:66599) has role antineoplastic agent (CHEBI:35610) |
| luzonial B (CHEBI:66599) has role metabolite (CHEBI:25212) |
| luzonial B (CHEBI:66599) is a aldehyde (CHEBI:17478) |
| luzonial B (CHEBI:66599) is a cinnamate ester (CHEBI:36087) |
| luzonial B (CHEBI:66599) is a cyclic ether (CHEBI:37407) |
| luzonial B (CHEBI:66599) is a iridoid monoterpenoid (CHEBI:50563) |
| luzonial B (CHEBI:66599) is a organic heterobicyclic compound (CHEBI:27171) |
| luzonial B (CHEBI:66599) is a phenols (CHEBI:33853) |
| luzonial B (CHEBI:66599) is a secondary alcohol (CHEBI:35681) |
| luzonial B (CHEBI:66599) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,3aS,4S,6S,6aS)-1,3a-dihydroxy-6-(3-oxoprop-1-en-2-yl)hexahydro-1H-cyclopenta[c]furan-4-yl (2Z)-3-(4-hydroxyphenyl)prop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10132478 | Reaxys |
| Citations |
|---|