EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H27O14 |
| Net Charge | +1 |
| Average Mass | 611.532 |
| Monoisotopic Mass | 611.13953 |
| SMILES | O=C(/C=C\c1ccc(O)cc1)OC[C@H]1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H26O14/c31-15-4-1-13(2-5-15)3-6-24(36)41-12-23-26(38)27(39)28(40)30(44-23)43-22-11-17-18(33)9-16(32)10-21(17)42-29(22)14-7-19(34)25(37)20(35)8-14/h1-11,23,26-28,30,38-40H,12H2,(H5-,31,32,33,34,35,36,37)/p+1/t23-,26-,27+,28-,30-/m1/s1 |
| InChIKey | DHTPVCYNNWQRMN-LHRGPQAGSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) has role metabolite (CHEBI:25212) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) is a anthocyanin cation (CHEBI:35218) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) is a cinnamate ester (CHEBI:36087) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) is a polyphenol (CHEBI:26195) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium-3-yl 6-O-[(2Z)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| delfinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) | ChEBI |
| delfinidin 3-O-(6-O-(Z)-p-coumaroyl-β-D-glucoside) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9605464 | Reaxys |