EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H60O8 |
| Net Charge | 0 |
| Average Mass | 765.000 |
| Monoisotopic Mass | 764.42882 |
| SMILES | [H][C@]12CC=C3[C@@](COC(=O)/C=C/c4ccc(O)cc4)(CC[C@@]4(C(=O)O)CCC(C)(C)C[C@@]34[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(=O)/C=C\c3ccc(O)cc3)CC[C@]21C |
| InChI | InChI=1S/C48H60O8/c1-43(2)25-26-47(42(53)54)27-28-48(30-55-40(51)19-11-31-7-13-33(49)14-8-31)35(36(47)29-43)17-18-38-45(5)23-22-39(44(3,4)37(45)21-24-46(38,48)6)56-41(52)20-12-32-9-15-34(50)16-10-32/h7-17,19-20,36-39,49-50H,18,21-30H2,1-6H3,(H,53,54)/b19-11+,20-12-/t36-,37-,38+,39-,45-,46+,47-,48-/m0/s1 |
| InChIKey | YBOIBOWMTWFCEG-AINGNVPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ilex asprella (ncbitaxon:185493) | leaf (BTO:0000713) | PubMed (8133297) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asprellic acid C (CHEBI:65456) has functional parent (3β)-3,27-dihydroxyolean-12-en-28-oic acid (CHEBI:71171) |
| asprellic acid C (CHEBI:65456) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| asprellic acid C (CHEBI:65456) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| asprellic acid C (CHEBI:65456) has role antineoplastic agent (CHEBI:35610) |
| asprellic acid C (CHEBI:65456) has role metabolite (CHEBI:25212) |
| asprellic acid C (CHEBI:65456) is a diester (CHEBI:51307) |
| asprellic acid C (CHEBI:65456) is a monocarboxylic acid (CHEBI:25384) |
| asprellic acid C (CHEBI:65456) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3β)-27-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}-3-{[(2Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}olean-12-en-28-oic acid |
| Synonym | Source |
|---|---|
| 3-O-cis-p-coumaroyl-27-O-trans-p-coumaroyl-3β,27-dihydroxy-olean-12-en-28-oic acid | ChEBI |
| Citations |
|---|