EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7O3 |
| Net Charge | -1 |
| Average Mass | 163.152 |
| Monoisotopic Mass | 163.04007 |
| SMILES | O=C([O-])/C=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/p-1/b6-3- |
| InChIKey | NGSWKAQJJWESNS-UTCJRWHESA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4-coumarate (CHEBI:58152) has role plant metabolite (CHEBI:76924) |
| cis-4-coumarate (CHEBI:58152) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| cis-4-coumarate (CHEBI:58152) is conjugate base of cis-4-coumaric acid (CHEBI:17450) |
| Incoming Relation(s) |
| cis-4-coumaric acid (CHEBI:17450) is conjugate acid of cis-4-coumarate (CHEBI:58152) |
| IUPAC Name |
|---|
| (2Z)-3-(4-hydroxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| (2Z)-3-(4-hydroxyphenyl)acrylate | IUPAC |
| cis-4-coumarate(1−) | ChEBI |
| cis-4-coumarate anion | ChEBI |
| (Z)-4-hydroxycinnamate | ChEBI |
| (Z)-p-hydroxycinnamate | ChEBI |
| UniProt Name | Source |
|---|---|
| cis-4-coumarate | UniProt |