EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O8 |
| Net Charge | 0 |
| Average Mass | 296.231 |
| Monoisotopic Mass | 296.05322 |
| SMILES | O=C(/C=C\c1ccc(O)cc1)O[C@H](C(=O)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3-/t10-,11+/m1/s1 |
| InChIKey | INYJZRKTYXTZHP-APUFIWCYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-cis-coutaric acid (CHEBI:76096) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| (2R,3S)-cis-coutaric acid (CHEBI:76096) has functional parent meso-tartaric acid (CHEBI:15673) |
| (2R,3S)-cis-coutaric acid (CHEBI:76096) has role metabolite (CHEBI:25212) |
| (2R,3S)-cis-coutaric acid (CHEBI:76096) is a p-coutaric acid (CHEBI:77439) |
| IUPAC Name |
|---|
| (2R,3S)-2-hydroxy-3-{[(2Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid |
| Synonym | Source |
|---|---|
| cis-coutaric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11155680 | Reaxys |