EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:76093 - 3-O-(cis-4-coumaroyl)-β-D-glucopyranose
| Formula | C15H18O8 |
| Net Charge | 0 |
| Average Mass | 326.301 |
| Monoisotopic Mass | 326.10017 |
| SMILES | O=C(/C=C\c1ccc(O)cc1)O[C@@H]1[C@@H](O)[C@H](O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C15H18O8/c16-7-10-12(19)14(13(20)15(21)22-10)23-11(18)6-3-8-1-4-9(17)5-2-8/h1-6,10,12-17,19-21H,7H2/b6-3-/t10-,12-,13-,14+,15-/m1/s1 |
| InChIKey | BYOUHUPERRXZGM-XKHXFKQHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-(cis-4-coumaroyl)-β-D-glucopyranose (CHEBI:76093) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| 3-O-(cis-4-coumaroyl)-β-D-glucopyranose (CHEBI:76093) has functional parent β-D-glucose (CHEBI:15903) |
| 3-O-(cis-4-coumaroyl)-β-D-glucopyranose (CHEBI:76093) has role metabolite (CHEBI:25212) |
| 3-O-(cis-4-coumaroyl)-β-D-glucopyranose (CHEBI:76093) is a O-acyl carbohydrate (CHEBI:52782) |
| 3-O-(cis-4-coumaroyl)-β-D-glucopyranose (CHEBI:76093) is a cinnamate ester (CHEBI:36087) |
| 3-O-(cis-4-coumaroyl)-β-D-glucopyranose (CHEBI:76093) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-O-[(2Z)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 3-O-(cis-4-coumaroyl)-β-D-glucose | ChEBI |
| 3-(cis-4-coumaroyl)-β-D-glucose | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3086192 | Reaxys |