EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28971 - ampicillin
| Formula | C16H19N3O4S |
| Net Charge | 0 |
| Average Mass | 349.412 |
| Monoisotopic Mass | 349.10963 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1 |
| InChIKey | AVKUERGKIZMTKX-NJBDSQKTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ampicillin (CHEBI:28971) has role antibacterial drug (CHEBI:36047) |
| ampicillin (CHEBI:28971) is a penicillin (CHEBI:17334) |
| ampicillin (CHEBI:28971) is a penicillin allergen (CHEBI:88187) |
| ampicillin (CHEBI:28971) is a β-lactam antibiotic (CHEBI:27933) |
| ampicillin (CHEBI:28971) is conjugate acid of ampicillin(1−) (CHEBI:50658) |
| Incoming Relation(s) |
| ampicilloyl-butylamine (CHEBI:55473) has functional parent ampicillin (CHEBI:28971) |
| bacampicillin (CHEBI:2968) has functional parent ampicillin (CHEBI:28971) |
| epicillin (CHEBI:58974) has functional parent ampicillin (CHEBI:28971) |
| lenampicillin (CHEBI:135748) has functional parent ampicillin (CHEBI:28971) |
| pivampicillin (CHEBI:8255) has functional parent ampicillin (CHEBI:28971) |
| sultamicillin (CHEBI:51770) has functional parent ampicillin (CHEBI:28971) |
| talampicillin (CHEBI:9391) has functional parent ampicillin (CHEBI:28971) |
| ampicillin trihydrate (CHEBI:31209) has part ampicillin (CHEBI:28971) |
| ampicillin(1−) (CHEBI:50658) is conjugate base of ampicillin (CHEBI:28971) |
| ampicilloyl group (CHEBI:53704) is substituent group from ampicillin (CHEBI:28971) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-amino-2-phenylacetamido]-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| ampicillin | ChemIDplus |
| ampicilina | ChemIDplus |
| ampicilline | ChemIDplus |
| ampicillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Ampicillin | KEGG COMPOUND |
| Anhydrous ampicillin | KEGG COMPOUND |
| (2S,5R,6R)-6-{[(2R)-2-AMINO-2-PHENYLETHANOYL]AMINO}-3,3-DIMETHYL-7-OXO-4-THIA-1-AZABICYCLO[3.2.0]HEPTANE-2-CARBOXYLIC ACID | PDBeChem |
| (2S,6R)-6-{[(2R)-2-amino-2-phenylethanoyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | PDBeChem |
| aminobenzylpenicillin | DrugBank |
| ampicillin acid | DrugBank |
| Citations |
|---|