EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:58974 - epicillin
| Formula | C16H21N3O4S |
| Net Charge | 0 |
| Average Mass | 351.428 |
| Monoisotopic Mass | 351.12528 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)C1=CCC=CC1 |
| InChI | InChI=1S/C16H21N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-4,7,9-11,14H,5-6,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1 |
| InChIKey | RPBAFSBGYDKNRG-NJBDSQKTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epicillin (CHEBI:58974) has functional parent ampicillin (CHEBI:28971) |
| epicillin (CHEBI:58974) is a penicillin (CHEBI:17334) |
| epicillin (CHEBI:58974) is a penicillin allergen (CHEBI:88187) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-amino-2-(cyclohexa-1,4-dien-1-yl)acetamido]-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| epicilina | ChemIDplus |
| epicillin | ChemIDplus |
| epicilline | ChemIDplus |
| epicillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Dexacillin | ChemIDplus |
| Dihydroampicillin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1091831 | Reaxys |
| CAS:26774-90-3 | ChemIDplus |
| Citations |
|---|