EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N3O7S |
| Net Charge | 0 |
| Average Mass | 465.528 |
| Monoisotopic Mass | 465.15697 |
| SMILES | [H][C@]12SC(C)(C)[C@]([H])(C(=O)OC(C)OC(=O)OCC)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O7S/c1-5-29-20(28)31-11(2)30-19(27)15-21(3,4)32-18-14(17(26)24(15)18)23-16(25)13(22)12-9-7-6-8-10-12/h6-11,13-15,18H,5,22H2,1-4H3,(H,23,25)/t11?,13-,14-,15+,18-/m1/s1 |
| InChIKey | PFOLLRNADZZWEX-FFGRCDKISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bacampicillin (CHEBI:2968) has functional parent ampicillin (CHEBI:28971) |
| bacampicillin (CHEBI:2968) has role prodrug (CHEBI:50266) |
| bacampicillin (CHEBI:2968) is a penicillanic acid ester (CHEBI:51212) |
| Incoming Relation(s) |
| bacampicillin hydrochloride (CHEBI:2969) has part bacampicillin (CHEBI:2968) |
| IUPAC Name |
|---|
| 1-[(ethoxycarbonyl)oxy]ethyl 6β-[(2R)-2-amino-2-phenylacetamido]-2,2-dimethylpenam-3α-carboxylate |
| INNs | Source |
|---|---|
| bacampicilina | ChemIDplus |
| bacampicillin | KEGG DRUG |
| bacampicilline | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-[(ethoxycarbonyl)oxy]ethyl (2S,5R,6R)-6-{[(2R)-2-amino-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| 1'-ethoxycarbonyloxyethyl-(6-D-α-aminophenylacetamido)penicillanate | ChemIDplus |
| bacampicillinum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 280 | DrugCentral |
| Bacampicillin | Wikipedia |
| C08122 | KEGG COMPOUND |
| D07487 | KEGG DRUG |
| DB01602 | DrugBank |
| DE2144457 | Patent |
| HMDB0015540 | HMDB |
| US3873521 | Patent |
| US3939270 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5784318 | Reaxys |
| CAS:50972-17-3 | ChemIDplus |
| CAS:50972-17-3 | KEGG COMPOUND |
| Citations |
|---|