EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23N3O6S |
| Net Charge | 0 |
| Average Mass | 481.530 |
| Monoisotopic Mass | 481.13076 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)OC3OC(=O)c4ccccc43)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O6S/c1-24(2)17(22(31)33-23-14-11-7-6-10-13(14)21(30)32-23)27-19(29)16(20(27)34-24)26-18(28)15(25)12-8-4-3-5-9-12/h3-11,15-17,20,23H,25H2,1-2H3,(H,26,28)/t15-,16-,17+,20-,23?/m1/s1 |
| InChIKey | SOROUYSPFADXSN-SUWVAFIASA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talampicillin (CHEBI:9391) has functional parent o-phthalaldehydic acid (CHEBI:495639) |
| talampicillin (CHEBI:9391) has functional parent ampicillin (CHEBI:28971) |
| talampicillin (CHEBI:9391) has role prodrug (CHEBI:50266) |
| talampicillin (CHEBI:9391) is a penicillanic acid ester (CHEBI:51212) |
| Incoming Relation(s) |
| talampicillin hydrochloride (CHEBI:34993) has functional parent talampicillin (CHEBI:9391) |
| IUPAC Name |
|---|
| 3-oxo-1,3-dihydro-2-benzofuran-1-yl (2S,5R,6R)-6-{[(2R)-2-amino-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Synonym | Source |
|---|---|
| Talampicillin | KEGG COMPOUND |
| Citations |
|---|