EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N4O9S2 |
| Net Charge | 0 |
| Average Mass | 594.668 |
| Monoisotopic Mass | 594.14542 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)OCOC(=O)[C@@H]3N4C(=O)C[C@@]4([H])S(=O)(=O)C3(C)C)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C25H30N4O9S2/c1-24(2)17(29-20(32)16(21(29)39-24)27-19(31)15(26)12-8-6-5-7-9-12)22(33)37-11-38-23(34)18-25(3,4)40(35,36)14-10-13(30)28(14)18/h5-9,14-18,21H,10-11,26H2,1-4H3,(H,27,31)/t14-,15-,16-,17+,18+,21-/m1/s1 |
| InChIKey | OPYGFNJSCUDTBT-PMLPCWDUSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sultamicillin (CHEBI:51770) has functional parent ampicillin (CHEBI:28971) |
| sultamicillin (CHEBI:51770) has functional parent sulbactam (CHEBI:9321) |
| sultamicillin (CHEBI:51770) is a penicillanic acid ester (CHEBI:51212) |
| Incoming Relation(s) |
| sultamicillin tosylate (CHEBI:32170) has part sultamicillin (CHEBI:51770) |
| IUPAC Name |
|---|
| ({6β-[(2R)-2-amino-2-phenylacetamido]-2,2-dimethylpenam-3α-carbonyl}oxy)methyl 2,2-dimethylpenam-3α-carboxylate 1,1-dioxide |
| INN | Source |
|---|---|
| sultamicillin | ChemIDplus |
| Synonyms | Source |
|---|---|
| [(2,2-dimethyl-1,1-dioxidopenam-3α-carbonyl)oxy]methyl 6β-[(2R)-2-amino-2-phenylacetamido]-2,2-dimethylpenam-3α-carboxylate | IUPAC |
| sultamicilina | ChemIDplus |
| sultamicillinum | ChemIDplus |
| VD 1827 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8958037 | Beilstein |
| CAS:76497-13-7 | ChemIDplus |