EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N3O4S |
| Net Charge | -1 |
| Average Mass | 348.404 |
| Monoisotopic Mass | 348.10235 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23)/p-1/t9-,10-,11+,14-/m1/s1 |
| InChIKey | AVKUERGKIZMTKX-NJBDSQKTSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ampicillin(1−) (CHEBI:50658) is a penicillinate anion (CHEBI:51356) |
| ampicillin(1−) (CHEBI:50658) is conjugate base of ampicillin (CHEBI:28971) |
| Incoming Relation(s) |
| ampicillin benzathine (CHEBI:51343) has part ampicillin(1−) (CHEBI:50658) |
| ampicillin potassium (CHEBI:51342) has part ampicillin(1−) (CHEBI:50658) |
| ampicillin sodium (CHEBI:34535) has part ampicillin(1−) (CHEBI:50658) |
| ampicillin (CHEBI:28971) is conjugate acid of ampicillin(1−) (CHEBI:50658) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-amino-2-phenylacetamido]-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-{[(2R)-2-amino-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| ampicillinate | ChEBI |