EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N3O7S |
| Net Charge | 0 |
| Average Mass | 461.496 |
| Monoisotopic Mass | 461.12567 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)OCc3oc(=O)oc3C)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O7S/c1-10-12(31-20(28)30-10)9-29-19(27)15-21(2,3)32-18-14(17(26)24(15)18)23-16(25)13(22)11-7-5-4-6-8-11/h4-8,13-15,18H,9,22H2,1-3H3,(H,23,25)/t13-,14-,15+,18-/m1/s1 |
| InChIKey | ZKUKMWMSYCIYRD-ZXFNITATSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenampicillin (CHEBI:135748) has functional parent ampicillin (CHEBI:28971) |
| lenampicillin (CHEBI:135748) has role prodrug (CHEBI:50266) |
| lenampicillin (CHEBI:135748) is a ketene acetal (CHEBI:145408) |
| lenampicillin (CHEBI:135748) is a penicillanic acid ester (CHEBI:51212) |
| IUPAC Name |
|---|
| (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (2S,5R,6R)-6-{[(2R)-2-amino-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| INNs | Source |
|---|---|
| lenampicilina | WHO MedNet |
| lenampicillin | ChemIDplus |
| lénampicilline | WHO MedNet |
| lenampicillinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ampicillin 5-methyl-2-oxo-1,3-dioxol-4-yl methyl ester | ChEBI |
| KBT 1585 | DrugCentral |
| KBT-1585 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:86273-18-9 | ChemIDplus |
| Citations |
|---|