EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N3O6S |
| Net Charge | 0 |
| Average Mass | 463.556 |
| Monoisotopic Mass | 463.17771 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O6S/c1-21(2,3)20(29)31-11-30-19(28)15-22(4,5)32-18-14(17(27)25(15)18)24-16(26)13(23)12-9-7-6-8-10-12/h6-10,13-15,18H,11,23H2,1-5H3,(H,24,26)/t13-,14-,15+,18-/m1/s1 |
| InChIKey | ZEMIJUDPLILVNQ-ZXFNITATSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pivampicillin (CHEBI:8255) has functional parent ampicillin (CHEBI:28971) |
| pivampicillin (CHEBI:8255) has role antibacterial agent (CHEBI:33282) |
| pivampicillin (CHEBI:8255) has role prodrug (CHEBI:50266) |
| pivampicillin (CHEBI:8255) is a penicillanic acid ester (CHEBI:51212) |
| pivampicillin (CHEBI:8255) is a pivaloyloxymethyl ester (CHEBI:136685) |
| IUPAC Name |
|---|
| [(2,2-dimethylpropanoyl)oxy]methyl 6β-[(2R)-2-amino-2-phenylacetamido]-2,2-dimethylpenam-3α-carboxylate |
| INNs | Source |
|---|---|
| pivampicilina | ChemIDplus |
| pivampicillin | ChemIDplus |
| pivampicilline | ChemIDplus |
| pivampicillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| ampicillin pivaloyloxymethyl ester | ChemIDplus |
| MK-191 | ChEMBL |
| pivaloyloxymethyl ampicillinate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pondocillin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2218 | DrugCentral |
| C11750 | KEGG COMPOUND |
| CN101612154 | Patent |
| D08396 | KEGG DRUG |
| DB01604 | DrugBank |
| LSM-6580 | LINCS |
| Pivampicillin | Wikipedia |
| US3660575 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5406076 | Beilstein |
| CAS:33817-20-8 | ChemIDplus |
| CAS:33817-20-8 | KEGG COMPOUND |
| Citations |
|---|