EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N4O4S |
| Net Charge | 0 |
| Average Mass | 422.551 |
| Monoisotopic Mass | 422.19878 |
| SMILES | [H][C@@]1([C@H](NC(=O)[C@H](N)c2ccccc2)C(=O)NCCCC)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C20H30N4O4S/c1-4-5-11-22-17(26)14(18-24-15(19(27)28)20(2,3)29-18)23-16(25)13(21)12-9-7-6-8-10-12/h6-10,13-15,18,24H,4-5,11,21H2,1-3H3,(H,22,26)(H,23,25)(H,27,28)/t13-,14-,15+,18-/m1/s1 |
| InChIKey | DEUIOQHUFBVJFK-ZXFNITATSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ampicilloyl-butylamine (CHEBI:55473) has functional parent ampicillin (CHEBI:28971) |
| ampicilloyl-butylamine (CHEBI:55473) has part ampicilloyl group (CHEBI:53704) |
| ampicilloyl-butylamine (CHEBI:55473) is a monocarboxylic acid amide (CHEBI:29347) |
| ampicilloyl-butylamine (CHEBI:55473) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| IUPAC Name |
|---|
| (2R,4S)-2-[(1R)-1-{[(2R)-2-amino-2-phenylacetyl]amino}-2-(butylamino)-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| Amp-BA | ChEBI |
| AMP-BA | ChEBI |
| AMP-butylamine | ChEBI |
| ampicilloyl butylamine | ChEBI |
| Citations |
|---|