EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO2 |
| Net Charge | 0 |
| Average Mass | 123.111 |
| Monoisotopic Mass | 123.03203 |
| SMILES | O=C(O)c1cccnc1 |
| InChI | InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9) |
| InChIKey | PVNIIMVLHYAWGP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. EC 3.5.1.19 (nicotinamidase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the action of nicotinamidase (EC 3.5.1.19). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antidote Any protective agent counteracting or neutralizing the action of poisons. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). vasodilator agent A drug used to cause dilation of the blood vessels. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicotinic acid (CHEBI:15940) has role Escherichia coli metabolite (CHEBI:76971) |
| nicotinic acid (CHEBI:15940) has role antidote (CHEBI:50247) |
| nicotinic acid (CHEBI:15940) has role antilipemic drug (CHEBI:35679) |
| nicotinic acid (CHEBI:15940) has role EC 3.5.1.19 (nicotinamidase) inhibitor (CHEBI:84264) |
| nicotinic acid (CHEBI:15940) has role human urinary metabolite (CHEBI:84087) |
| nicotinic acid (CHEBI:15940) has role metabolite (CHEBI:25212) |
| nicotinic acid (CHEBI:15940) has role mouse metabolite (CHEBI:75771) |
| nicotinic acid (CHEBI:15940) has role plant metabolite (CHEBI:76924) |
| nicotinic acid (CHEBI:15940) has role vasodilator agent (CHEBI:35620) |
| nicotinic acid (CHEBI:15940) is a pyridine alkaloid (CHEBI:26416) |
| nicotinic acid (CHEBI:15940) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| nicotinic acid (CHEBI:15940) is a vitamin B3 (CHEBI:176839) |
| nicotinic acid (CHEBI:15940) is conjugate acid of nicotinate (CHEBI:32544) |
| Incoming Relation(s) |
| Euphorbia diterpenoid 2 (CHEBI:65884) has functional parent nicotinic acid (CHEBI:15940) |
| N-methylnicotinic acid (CHEBI:50521) has functional parent nicotinic acid (CHEBI:15940) |
| myo-inositol hexanicotinate (CHEBI:31699) has functional parent nicotinic acid (CHEBI:15940) |
| D-ribosylnicotinic acid (CHEBI:27748) has functional parent nicotinic acid (CHEBI:15940) |
| 1,4,5,6-tetrahydro-6-oxonicotinic acid (CHEBI:16453) has functional parent nicotinic acid (CHEBI:15940) |
| 2-aminonicotinic acid (CHEBI:68572) has functional parent nicotinic acid (CHEBI:15940) |
| 2,6-dihydroxynicotinic acid (CHEBI:49087) has functional parent nicotinic acid (CHEBI:15940) |
| 4-aminonicotinic acid (CHEBI:68577) has functional parent nicotinic acid (CHEBI:15940) |
| 4-methoxy-1-methyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid (CHEBI:17693) has functional parent nicotinic acid (CHEBI:15940) |
| 5-aminonicotinic acid (CHEBI:68578) has functional parent nicotinic acid (CHEBI:15940) |
| 5-hydroxy-6-methylpyridine-3-carboxylic acid (CHEBI:15821) has functional parent nicotinic acid (CHEBI:15940) |
| 5-pyridoxic acid (CHEBI:16409) has functional parent nicotinic acid (CHEBI:15940) |
| 6-aminonicotinic acid (CHEBI:68583) has functional parent nicotinic acid (CHEBI:15940) |
| 6-hydroxynicotinic acid (CHEBI:16168) has functional parent nicotinic acid (CHEBI:15940) |
| benzyl nicotinate (CHEBI:31268) has functional parent nicotinic acid (CHEBI:15940) |
| boscalid (CHEBI:81822) has functional parent nicotinic acid (CHEBI:15940) |
| clonixin (CHEBI:76200) has functional parent nicotinic acid (CHEBI:15940) |
| cyclitol nicotinate (CHEBI:50135) has functional parent nicotinic acid (CHEBI:15940) |
| flunixin (CHEBI:76138) has functional parent nicotinic acid (CHEBI:15940) |
| hyponine D (CHEBI:132388) has functional parent nicotinic acid (CHEBI:15940) |
| hyponine E (CHEBI:132389) has functional parent nicotinic acid (CHEBI:15940) |
| inositol hexanicotinate (CHEBI:33064) has functional parent nicotinic acid (CHEBI:15940) |
| nicotinamide (CHEBI:17154) has functional parent nicotinic acid (CHEBI:15940) |
| regelidine (CHEBI:132396) has functional parent nicotinic acid (CHEBI:15940) |
| vitamin B complex (CHEBI:75782) has part nicotinic acid (CHEBI:15940) |
| nicotinic-d4 acid (CHEBI:145116) is a nicotinic acid (CHEBI:15940) |
| nicotinate (CHEBI:32544) is conjugate base of nicotinic acid (CHEBI:15940) |
| IUPAC Names |
|---|
| nicotinic acid |
| pyridine-3-carboxylic acid |
| INNs | Source |
|---|---|
| acide nicotinique | WHO MedNet |
| ácido nicotínico | WHO MedNet |
| acidum nicotinicum | WHO MedNet |
| nicotinic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-carboxylpyridine | ChemIDplus |
| 3-carboxypyridine | NIST Chemistry WebBook |
| 3-pyridinecarboxylic acid | KEGG COMPOUND |
| 3-Pyridylcarboxylic acid | HMDB |
| anti-pellagra vitamin | NIST Chemistry WebBook |
| m-pyridinecarboxylic acid | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Niacor | KEGG DRUG |
| Niaspan | KEGG DRUG |
| Citations |
|---|