EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:76200 - clonixin
| Formula | C13H11ClN2O2 |
| Net Charge | 0 |
| Average Mass | 262.696 |
| Monoisotopic Mass | 262.05091 |
| SMILES | Cc1c(Cl)cccc1Nc1ncccc1C(=O)O |
| InChI | InChI=1S/C13H11ClN2O2/c1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2-7H,1H3,(H,15,16)(H,17,18) |
| InChIKey | CLOMYZFHNHFSIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clonixin (CHEBI:76200) has functional parent nicotinic acid (CHEBI:15940) |
| clonixin (CHEBI:76200) has role antipyretic (CHEBI:35493) |
| clonixin (CHEBI:76200) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| clonixin (CHEBI:76200) has role lipoxygenase inhibitor (CHEBI:35856) |
| clonixin (CHEBI:76200) has role non-narcotic analgesic (CHEBI:35481) |
| clonixin (CHEBI:76200) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| clonixin (CHEBI:76200) has role platelet aggregation inhibitor (CHEBI:50427) |
| clonixin (CHEBI:76200) has role vasodilator agent (CHEBI:35620) |
| clonixin (CHEBI:76200) is a aminopyridine (CHEBI:38207) |
| clonixin (CHEBI:76200) is a organochlorine compound (CHEBI:36683) |
| clonixin (CHEBI:76200) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| clonixin (CHEBI:76200) is conjugate acid of clonixin(1−) (CHEBI:76203) |
| Incoming Relation(s) |
| clonixin(1−) (CHEBI:76203) is conjugate base of clonixin (CHEBI:76200) |
| IUPAC Name |
|---|
| 2-[(3-chloro-2-methylphenyl)amino]nicotinic acid |
| INNs | Source |
|---|---|
| clonixin | KEGG DRUG |
| clonixino | ChemIDplus |
| clonixinum | ChemIDplus |
| clonixine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(3-Chloro-2-methylanilino)nicotinic acid | ChemIDplus |
| CBA 93626 | ChemIDplus |
| 2-(2'-Methyl-3'-chloro)anilinonicotinic acid | ChemIDplus |
| 2-(3-Chloro-o-toluidino)nicotinic acid | ChemIDplus |
| Clonixic acid | ChemIDplus |
| Sch 10304 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03555 | KEGG DRUG |
| US2008014272 | Patent |
| US2005163847 | Patent |
| 705 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:483212 | Reaxys |
| CAS:17737-65-4 | KEGG DRUG |
| CAS:17737-65-4 | ChemIDplus |
| Citations |
|---|