EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N2O2 |
| Net Charge | 0 |
| Average Mass | 138.126 |
| Monoisotopic Mass | 138.04293 |
| SMILES | Nc1ncccc1C(=O)O |
| InChI | InChI=1S/C6H6N2O2/c7-5-4(6(9)10)2-1-3-8-5/h1-3H,(H2,7,8)(H,9,10) |
| InChIKey | KPIVDNYJNOPGBE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminonicotinic acid (CHEBI:68572) has functional parent nicotinic acid (CHEBI:15940) |
| 2-aminonicotinic acid (CHEBI:68572) has role metabolite (CHEBI:25212) |
| 2-aminonicotinic acid (CHEBI:68572) is a aminonicotinic acid (CHEBI:73130) |
| 2-aminonicotinic acid (CHEBI:68572) is a aminopyridine (CHEBI:38207) |
| IUPAC Name |
|---|
| 2-aminopyridine-3-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:119031 | Reaxys |
| CAS:5345-47-1 | ChemIDplus |
| Citations |
|---|