EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11F3N2O2 |
| Net Charge | 0 |
| Average Mass | 296.248 |
| Monoisotopic Mass | 296.07726 |
| SMILES | Cc1c(Nc2ncccc2C(=O)O)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H11F3N2O2/c1-8-10(14(15,16)17)5-2-6-11(8)19-12-9(13(20)21)4-3-7-18-12/h2-7H,1H3,(H,18,19)(H,20,21) |
| InChIKey | NOOCSNJCXJYGPE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flunixin (CHEBI:76138) has functional parent nicotinic acid (CHEBI:15940) |
| flunixin (CHEBI:76138) has role antipyretic (CHEBI:35493) |
| flunixin (CHEBI:76138) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| flunixin (CHEBI:76138) has role non-narcotic analgesic (CHEBI:35481) |
| flunixin (CHEBI:76138) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| flunixin (CHEBI:76138) is a aminopyridine (CHEBI:38207) |
| flunixin (CHEBI:76138) is a organofluorine compound (CHEBI:37143) |
| flunixin (CHEBI:76138) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| flunixin (CHEBI:76138) is conjugate acid of flunixin(1−) (CHEBI:76153) |
| Incoming Relation(s) |
| flunixin(1−) (CHEBI:76153) is conjugate base of flunixin (CHEBI:76138) |
| IUPAC Name |
|---|
| 2-{[2-methyl-3-(trifluoromethyl)phenyl]amino}nicotinic acid |
| INNs | Source |
|---|---|
| flunixin | KEGG DRUG |
| flunixine | ChemIDplus |
| flunixino | ChemIDplus |
| flunixinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-((2-methyl-3-(trifluoromethyl)phenyl)amino)-3-pyridinecarboxylic acid | ChemIDplus |
| 2-(α3,α3,α3-trifluoro-2,3-xylidino)nicotinic acid | ChemIDplus |
| Sch 14714 | ChemIDplus |
| SCH-14714 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1802 | VSDB |
| D04215 | KEGG DRUG |
| Flunixin | Wikipedia |
| US2008014272 | Patent |
| US5637617 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:492802 | Reaxys |
| CAS:38677-85-9 | KEGG DRUG |
| CAS:38677-85-9 | ChemIDplus |
| Citations |
|---|